CAS:4122-68-3|4-Chlorophenoxyacetyl Chloride
Molecular Formula:C8H6O2Cl2
Molecular Weight:205.03 g/mol
Purity:98 percent
Package:5g/10g/25g/50g/bulk package
- Dostava širom svijeta
- Osiguranje kvaliteta
- Služba za korisnike 24/7
Uvod u proizvod
4-Chlorophenoxyacetyl chloride(CAS:4122-68-3) is used in a variety of scientific research applications. It is used as a reagent in the synthesis of various organic compounds such as esters, amides, and amines. It is also used in the synthesis of pharmaceuticals such as anti-inflammatory drugs, antifungal agents, and antibiotics. P-CPA is also utilized in the synthesis of polymers, dyes, and pigments.
|
|
|
| 2-(4-chlorophenoxy)acetyl chloride | |
| MFCD00000727 | |
| 165 degree /20mmHg(lit.) | |
| 18.8 degree C (lit.) | |
| 112.9ºC | |
| 1.314g/ml | |
| 26.30 | |
| 2.48 | |
| Colorless - Pale yellow Clear Liquid | |
| 1.5486(lit.) | |
| InChI=1S/C8H6Cl2O2/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2 | |
| VRBVHQUSAOKVDH-UHFFFAOYSA-N |
Popularni tagovi: cas:4122-68-3|4-chlorophenoxyacetyl chloride, price, quotation, discount, in stock, for sale
